C20H25F3N4O3 — CID 111215077
1-[2-(3,4-dimethoxyphenyl)ethyl]-2-methyl-3-[[2-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]guanidine (PubChem CID 111215077) has the molecular formula C20H25F3N4O3 and a molecular weight of 426.44 g/mol. Its IUPAC name is 1-[2-(3,4-dimethoxyphenyl)ethyl]-2-methyl-3-[[2-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]guanidine.
| Compound Name | 1-[2-(3,4-dimethoxyphenyl)ethyl]-2-methyl-3-[[2-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]guanidine |
|---|---|
| PubChem CID | 111215077 |
| Molecular Formula | C20H25F3N4O3 |
| Molecular Weight | 426.44 g/mol |
| Exact Mass | 426.19 |
| IUPAC Name | 1-[2-(3,4-dimethoxyphenyl)ethyl]-2-methyl-3-[[2-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]guanidine |
| SMILES | C/N=C(/NCCc1ccc(OC)c(OC)c1)NCc1cccnc1OCC(F)(F)F |
| InChI | InChI=1S/C20H25F3N4O3/c1-24-19(26-10-8-14-6-7-16(28-2)17(11-14)29-3)27-12-15-5-4-9-25-18(15)30-13-20(21,22)23/h4-7,9,11H,8,10,12-13H2,1-3H3,(H2,24,26,27) |
| InChIKey | MRSSKTSFASPLSP-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 77.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.44 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|