C23H35IN4O4 — CID 111574530
1-[3-(3-ethoxy-4-methoxyphenyl)propyl]-3-[[2-(2-methoxyethoxy)-3-pyridinyl]methyl]-2-methylguanidine;hydroiodide (PubChem CID 111574530) has the molecular formula C23H35IN4O4 and a molecular weight of 558.46 g/mol. Its IUPAC name is 1-[3-(3-ethoxy-4-methoxyphenyl)propyl]-3-[[2-(2-methoxyethoxy)-3-pyridinyl]methyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[3-(3-ethoxy-4-methoxyphenyl)propyl]-3-[[2-(2-methoxyethoxy)-3-pyridinyl]methyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111574530 |
| Molecular Formula | C23H35IN4O4 |
| Molecular Weight | 558.46 g/mol |
| Exact Mass | 558.17 |
| IUPAC Name | 1-[3-(3-ethoxy-4-methoxyphenyl)propyl]-3-[[2-(2-methoxyethoxy)-3-pyridinyl]methyl]-2-methylguanidine;hydroiodide |
| SMILES | CCOc1cc(CCCN/C(=N/C)NCc2cccnc2OCCOC)ccc1OC.I |
| InChI | InChI=1S/C23H34N4O4.HI/c1-5-30-21-16-18(10-11-20(21)29-4)8-6-13-26-23(24-2)27-17-19-9-7-12-25-22(19)31-15-14-28-3;/h7,9-12,16H,5-6,8,13-15,17H2,1-4H3,(H2,24,26,27);1H |
| InChIKey | ZMYKSXRVRXTAHQ-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 86.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.46 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|