C19H22BrN7O — CID 111016449
4-bromo-N-[2-[[N-ethyl-N'-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)carbamimidoyl]amino]ethyl]benzamide (PubChem CID 111016449) has the molecular formula C19H22BrN7O and a molecular weight of 444.34 g/mol. Its IUPAC name is 4-bromo-N-[2-[[N-ethyl-N'-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)carbamimidoyl]amino]ethyl]benzamide.
| Compound Name | 4-bromo-N-[2-[[N-ethyl-N'-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)carbamimidoyl]amino]ethyl]benzamide |
|---|---|
| PubChem CID | 111016449 |
| Molecular Formula | C19H22BrN7O |
| Molecular Weight | 444.34 g/mol |
| Exact Mass | 443.11 |
| IUPAC Name | 4-bromo-N-[2-[[N-ethyl-N'-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)carbamimidoyl]amino]ethyl]benzamide |
| SMILES | CCN/C(=N\Cc1nnc2ccccn12)NCCNC(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C19H22BrN7O/c1-2-21-19(24-13-17-26-25-16-5-3-4-12-27(16)17)23-11-10-22-18(28)14-6-8-15(20)9-7-14/h3-9,12H,2,10-11,13H2,1H3,(H,22,28)(H2,21,23,24) |
| InChIKey | GTQAOEZQQSQRJX-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 95.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.34 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|