C18H28Cl2N4 — CID 111017431
1-[2-(3,5-dichlorophenyl)ethyl]-2-methyl-3-(1-propylpiperidin-4-yl)guanidine (PubChem CID 111017431) has the molecular formula C18H28Cl2N4 and a molecular weight of 371.36 g/mol. Its IUPAC name is 1-[2-(3,5-dichlorophenyl)ethyl]-2-methyl-3-(1-propylpiperidin-4-yl)guanidine.
| Compound Name | 1-[2-(3,5-dichlorophenyl)ethyl]-2-methyl-3-(1-propylpiperidin-4-yl)guanidine |
|---|---|
| PubChem CID | 111017431 |
| Molecular Formula | C18H28Cl2N4 |
| Molecular Weight | 371.36 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | 1-[2-(3,5-dichlorophenyl)ethyl]-2-methyl-3-(1-propylpiperidin-4-yl)guanidine |
| SMILES | CCCN1CCC(N/C(=N/C)NCCc2cc(Cl)cc(Cl)c2)CC1 |
| InChI | InChI=1S/C18H28Cl2N4/c1-3-8-24-9-5-17(6-10-24)23-18(21-2)22-7-4-14-11-15(19)13-16(20)12-14/h11-13,17H,3-10H2,1-2H3,(H2,21,22,23) |
| InChIKey | PTQXRUVEEVSZLS-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.36 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|