C21H37N5S — CID 111019307
1-ethyl-3-(1-propylpiperidin-4-yl)-2-[3-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)propyl]guanidine (PubChem CID 111019307) has the molecular formula C21H37N5S and a molecular weight of 391.63 g/mol. Its IUPAC name is 1-ethyl-3-(1-propylpiperidin-4-yl)-2-[3-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)propyl]guanidine.
| Compound Name | 1-ethyl-3-(1-propylpiperidin-4-yl)-2-[3-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)propyl]guanidine |
|---|---|
| PubChem CID | 111019307 |
| Molecular Formula | C21H37N5S |
| Molecular Weight | 391.63 g/mol |
| Exact Mass | 391.28 |
| IUPAC Name | 1-ethyl-3-(1-propylpiperidin-4-yl)-2-[3-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)propyl]guanidine |
| SMILES | CCCN1CCC(N/C(=N/CCCc2nc3c(s2)CCCC3)NCC)CC1 |
| InChI | InChI=1S/C21H37N5S/c1-3-14-26-15-11-17(12-16-26)24-21(22-4-2)23-13-7-10-20-25-18-8-5-6-9-19(18)27-20/h17H,3-16H2,1-2H3,(H2,22,23,24) |
| InChIKey | IZMCEYHNRDHBHX-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 52.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.63 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|