C21H33NO10 — CID 11102562
methyl (1S,2R,6R,9R,11R)-11-[(2S)-3-methoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxopropyl]-4,4-dimethyl-3,5,8,12-tetraoxatricyclo[7.3.0.02,6]dodecane-11-carboxylate (PubChem CID 11102562) has the molecular formula C21H33NO10 and a molecular weight of 459.49 g/mol. Its IUPAC name is methyl (1S,2R,6R,9R,11R)-11-[(2S)-3-methoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxopropyl]-4,4-dimethyl-3,5,8,12-tetraoxatricyclo[7.3.0.02,6]dodecane-11-carboxylate.
| Compound Name | methyl (1S,2R,6R,9R,11R)-11-[(2S)-3-methoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxopropyl]-4,4-dimethyl-3,5,8,12-tetraoxatricyclo[7.3.0.02,6]dodecane-11-carboxylate |
|---|---|
| PubChem CID | 11102562 |
| Molecular Formula | C21H33NO10 |
| Molecular Weight | 459.49 g/mol |
| Exact Mass | 459.21 |
| IUPAC Name | methyl (1S,2R,6R,9R,11R)-11-[(2S)-3-methoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxopropyl]-4,4-dimethyl-3,5,8,12-tetraoxatricyclo[7.3.0.02,6]dodecane-11-carboxylate |
| SMILES | COC(=O)[C@H](C[C@]1(C(=O)OC)C[C@H]2OC[C@H]3OC(C)(C)O[C@H]3[C@H]2O1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H33NO10/c1-19(2,3)32-18(25)22-11(16(23)26-6)8-21(17(24)27-7)9-12-14(31-21)15-13(10-28-12)29-20(4,5)30-15/h11-15H,8-10H2,1-7H3,(H,22,25)/t11-,12+,13+,14-,15+,21+/m0/s1 |
| InChIKey | JGTADBIKIYBJDA-QGPHIVBGSA-N |
| XLogP | 1.06 |
| TPSA | 127.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.49 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|