C23H35NO9 — CID 54762770
ditert-butyl (1S,2R,2'S,6R,9R,11R)-4,4-dimethyl-5'-oxospiro[3,5,8,12-tetraoxatricyclo[7.3.0.02,6]dodecane-11,4'-pyrrolidine]-1',2'-dicarboxylate (PubChem CID 54762770) has the molecular formula C23H35NO9 and a molecular weight of 469.53 g/mol. Its IUPAC name is ditert-butyl (1S,2R,2'S,6R,9R,11R)-4,4-dimethyl-5'-oxospiro[3,5,8,12-tetraoxatricyclo[7.3.0.02,6]dodecane-11,4'-pyrrolidine]-1',2'-dicarboxylate.
| Compound Name | ditert-butyl (1S,2R,2'S,6R,9R,11R)-4,4-dimethyl-5'-oxospiro[3,5,8,12-tetraoxatricyclo[7.3.0.02,6]dodecane-11,4'-pyrrolidine]-1',2'-dicarboxylate |
|---|---|
| PubChem CID | 54762770 |
| Molecular Formula | C23H35NO9 |
| Molecular Weight | 469.53 g/mol |
| Exact Mass | 469.23 |
| IUPAC Name | ditert-butyl (1S,2R,2'S,6R,9R,11R)-4,4-dimethyl-5'-oxospiro[3,5,8,12-tetraoxatricyclo[7.3.0.02,6]dodecane-11,4'-pyrrolidine]-1',2'-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)[C@@H]1C[C@@]2(C[C@H]3OC[C@H]4OC(C)(C)O[C@H]4[C@H]3O2)C(=O)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H35NO9/c1-20(2,3)32-17(25)12-9-23(18(26)24(12)19(27)33-21(4,5)6)10-13-15(31-23)16-14(11-28-13)29-22(7,8)30-16/h12-16H,9-11H2,1-8H3/t12-,13+,14+,15-,16+,23+/m0/s1 |
| InChIKey | UYRFLVDXCJOODW-PTZYUYTLSA-N |
| XLogP | 2.31 |
| TPSA | 109.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.53 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |