C24H35NO11 — CID 11627664
1-O'-tert-butyl 2-O'-methyl (2R,2'S,3aR,6S,7R,7aS)-6-acetyloxy-7-(2,2-dimethylpropanoyloxy)-5'-oxospiro[3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyran-2,4'-pyrrolidine]-1',2'-dicarboxylate (PubChem CID 11627664) has the molecular formula C24H35NO11 and a molecular weight of 513.54 g/mol. Its IUPAC name is 1-O'-tert-butyl 2-O'-methyl (2R,2'S,3aR,6S,7R,7aS)-6-acetyloxy-7-(2,2-dimethylpropanoyloxy)-5'-oxospiro[3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyran-2,4'-pyrrolidine]-1',2'-dicarboxylate.
| Compound Name | 1-O'-tert-butyl 2-O'-methyl (2R,2'S,3aR,6S,7R,7aS)-6-acetyloxy-7-(2,2-dimethylpropanoyloxy)-5'-oxospiro[3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyran-2,4'-pyrrolidine]-1',2'-dicarboxylate |
|---|---|
| PubChem CID | 11627664 |
| Molecular Formula | C24H35NO11 |
| Molecular Weight | 513.54 g/mol |
| Exact Mass | 513.22 |
| IUPAC Name | 1-O'-tert-butyl 2-O'-methyl (2R,2'S,3aR,6S,7R,7aS)-6-acetyloxy-7-(2,2-dimethylpropanoyloxy)-5'-oxospiro[3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyran-2,4'-pyrrolidine]-1',2'-dicarboxylate |
| SMILES | COC(=O)[C@@H]1C[C@@]2(C[C@H]3OC[C@H](OC(C)=O)[C@@H](OC(=O)C(C)(C)C)[C@H]3O2)C(=O)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H35NO11/c1-12(26)33-15-11-32-14-10-24(35-17(14)16(15)34-20(29)22(2,3)4)9-13(18(27)31-8)25(19(24)28)21(30)36-23(5,6)7/h13-17H,9-11H2,1-8H3/t13-,14+,15-,16+,17-,24+/m0/s1 |
| InChIKey | HZVIFBPONSNDDG-LLAFKYMWSA-N |
| XLogP | 1.51 |
| TPSA | 143.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.54 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|