C25H39NO12 — CID 11577514
methyl (2R,3aR,6S,7R,7aS)-7-acetyloxy-6-(2,2-dimethylpropanoyloxy)-2-[(2S)-3-methoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxopropyl]-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyran-2-carboxylate (PubChem CID 11577514) has the molecular formula C25H39NO12 and a molecular weight of 545.58 g/mol. Its IUPAC name is methyl (2R,3aR,6S,7R,7aS)-7-acetyloxy-6-(2,2-dimethylpropanoyloxy)-2-[(2S)-3-methoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxopropyl]-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyran-2-carboxylate.
| Compound Name | methyl (2R,3aR,6S,7R,7aS)-7-acetyloxy-6-(2,2-dimethylpropanoyloxy)-2-[(2S)-3-methoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxopropyl]-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyran-2-carboxylate |
|---|---|
| PubChem CID | 11577514 |
| Molecular Formula | C25H39NO12 |
| Molecular Weight | 545.58 g/mol |
| Exact Mass | 545.25 |
| IUPAC Name | methyl (2R,3aR,6S,7R,7aS)-7-acetyloxy-6-(2,2-dimethylpropanoyloxy)-2-[(2S)-3-methoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxopropyl]-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyran-2-carboxylate |
| SMILES | COC(=O)[C@H](C[C@]1(C(=O)OC)C[C@H]2OC[C@H](OC(=O)C(C)(C)C)[C@@H](OC(C)=O)[C@H]2O1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C25H39NO12/c1-13(27)35-17-16(36-20(29)23(2,3)4)12-34-15-11-25(21(30)33-9,37-18(15)17)10-14(19(28)32-8)26-22(31)38-24(5,6)7/h14-18H,10-12H2,1-9H3,(H,26,31)/t14-,15+,16-,17+,18-,25+/m0/s1 |
| InChIKey | DBGHOWGYCIPWAN-LKHDEUKNSA-N |
| XLogP | 1.43 |
| TPSA | 161.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.58 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|