C22H29NO13 — CID 71813037
methyl (3aR,4R,6S,7aS)-3-acetyl-2-oxo-6-(2-oxopropyl)-4-[(1S,2R)-1,2,3-triacetyloxypropyl]-3a,4,7,7a-tetrahydropyrano[3,4-d][1,3]oxazole-6-carboxylate (PubChem CID 71813037) has the molecular formula C22H29NO13 and a molecular weight of 515.47 g/mol. Its IUPAC name is methyl (3aR,4R,6S,7aS)-3-acetyl-2-oxo-6-(2-oxopropyl)-4-[(1S,2R)-1,2,3-triacetyloxypropyl]-3a,4,7,7a-tetrahydropyrano[3,4-d][1,3]oxazole-6-carboxylate.
| Compound Name | methyl (3aR,4R,6S,7aS)-3-acetyl-2-oxo-6-(2-oxopropyl)-4-[(1S,2R)-1,2,3-triacetyloxypropyl]-3a,4,7,7a-tetrahydropyrano[3,4-d][1,3]oxazole-6-carboxylate |
|---|---|
| PubChem CID | 71813037 |
| Molecular Formula | C22H29NO13 |
| Molecular Weight | 515.47 g/mol |
| Exact Mass | 515.16 |
| IUPAC Name | methyl (3aR,4R,6S,7aS)-3-acetyl-2-oxo-6-(2-oxopropyl)-4-[(1S,2R)-1,2,3-triacetyloxypropyl]-3a,4,7,7a-tetrahydropyrano[3,4-d][1,3]oxazole-6-carboxylate |
| SMILES | COC(=O)[C@@]1(CC(C)=O)C[C@@H]2OC(=O)N(C(C)=O)[C@H]2[C@H]([C@H](OC(C)=O)[C@@H](COC(C)=O)OC(C)=O)O1 |
| InChI | InChI=1S/C22H29NO13/c1-10(24)7-22(20(29)31-6)8-15-17(23(11(2)25)21(30)35-15)19(36-22)18(34-14(5)28)16(33-13(4)27)9-32-12(3)26/h15-19H,7-9H2,1-6H3/t15-,16+,17+,18+,19+,22+/m0/s1 |
| InChIKey | YJWVRMDMTMSHQE-SYQAMQCGSA-N |
| XLogP | -0.17 |
| TPSA | 178.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.47 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|