C23H31NO12 — CID 71813645
methyl (3aR,4R,6R,7aS)-3-acetyl-6-(2-methylprop-2-enyl)-2-oxo-4-[(1S,2R)-1,2,3-triacetyloxypropyl]-3a,4,7,7a-tetrahydropyrano[3,4-d][1,3]oxazole-6-carboxylate (PubChem CID 71813645) has the molecular formula C23H31NO12 and a molecular weight of 513.50 g/mol. Its IUPAC name is methyl (3aR,4R,6R,7aS)-3-acetyl-6-(2-methylprop-2-enyl)-2-oxo-4-[(1S,2R)-1,2,3-triacetyloxypropyl]-3a,4,7,7a-tetrahydropyrano[3,4-d][1,3]oxazole-6-carboxylate.
| Compound Name | methyl (3aR,4R,6R,7aS)-3-acetyl-6-(2-methylprop-2-enyl)-2-oxo-4-[(1S,2R)-1,2,3-triacetyloxypropyl]-3a,4,7,7a-tetrahydropyrano[3,4-d][1,3]oxazole-6-carboxylate |
|---|---|
| PubChem CID | 71813645 |
| Molecular Formula | C23H31NO12 |
| Molecular Weight | 513.50 g/mol |
| Exact Mass | 513.18 |
| IUPAC Name | methyl (3aR,4R,6R,7aS)-3-acetyl-6-(2-methylprop-2-enyl)-2-oxo-4-[(1S,2R)-1,2,3-triacetyloxypropyl]-3a,4,7,7a-tetrahydropyrano[3,4-d][1,3]oxazole-6-carboxylate |
| SMILES | C=C(C)C[C@]1(C(=O)OC)C[C@@H]2OC(=O)N(C(C)=O)[C@H]2[C@H]([C@H](OC(C)=O)[C@@H](COC(C)=O)OC(C)=O)O1 |
| InChI | InChI=1S/C23H31NO12/c1-11(2)8-23(21(29)31-7)9-16-18(24(12(3)25)22(30)35-16)20(36-23)19(34-15(6)28)17(33-14(5)27)10-32-13(4)26/h16-20H,1,8-10H2,2-7H3/t16-,17+,18+,19+,20+,23+/m0/s1 |
| InChIKey | BMRPJEJJQNIGCZ-GCIBVHORSA-N |
| XLogP | 0.82 |
| TPSA | 161.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.50 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|