C17H25IN4O3 — CID 111027561
1-(2,5-dimethoxyphenyl)-2-[2-(dimethylamino)-2-(furan-2-yl)ethyl]guanidine;hydroiodide (PubChem CID 111027561) has the molecular formula C17H25IN4O3 and a molecular weight of 460.32 g/mol. Its IUPAC name is 1-(2,5-dimethoxyphenyl)-2-[2-(dimethylamino)-2-(furan-2-yl)ethyl]guanidine;hydroiodide.
| Compound Name | 1-(2,5-dimethoxyphenyl)-2-[2-(dimethylamino)-2-(furan-2-yl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111027561 |
| Molecular Formula | C17H25IN4O3 |
| Molecular Weight | 460.32 g/mol |
| Exact Mass | 460.10 |
| IUPAC Name | 1-(2,5-dimethoxyphenyl)-2-[2-(dimethylamino)-2-(furan-2-yl)ethyl]guanidine;hydroiodide |
| SMILES | COc1ccc(OC)c(N/C(N)=N/CC(c2ccco2)N(C)C)c1.I |
| InChI | InChI=1S/C17H24N4O3.HI/c1-21(2)14(16-6-5-9-24-16)11-19-17(18)20-13-10-12(22-3)7-8-15(13)23-4;/h5-10,14H,11H2,1-4H3,(H3,18,19,20);1H |
| InChIKey | FIASMTAKWSIUIG-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.32 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|