C16H14ClF3N4O2 — CID 111028388
2-[[amino-(3-chloro-4-methoxyanilino)methylidene]amino]-N-(2,3,4-trifluorophenyl)acetamide (PubChem CID 111028388) has the molecular formula C16H14ClF3N4O2 and a molecular weight of 386.76 g/mol. Its IUPAC name is 2-[[amino-(3-chloro-4-methoxyanilino)methylidene]amino]-N-(2,3,4-trifluorophenyl)acetamide.
| Compound Name | 2-[[amino-(3-chloro-4-methoxyanilino)methylidene]amino]-N-(2,3,4-trifluorophenyl)acetamide |
|---|---|
| PubChem CID | 111028388 |
| Molecular Formula | C16H14ClF3N4O2 |
| Molecular Weight | 386.76 g/mol |
| Exact Mass | 386.08 |
| IUPAC Name | 2-[[amino-(3-chloro-4-methoxyanilino)methylidene]amino]-N-(2,3,4-trifluorophenyl)acetamide |
| SMILES | COc1ccc(N/C(N)=N/CC(=O)Nc2ccc(F)c(F)c2F)cc1Cl |
| InChI | InChI=1S/C16H14ClF3N4O2/c1-26-12-5-2-8(6-9(12)17)23-16(21)22-7-13(25)24-11-4-3-10(18)14(19)15(11)20/h2-6H,7H2,1H3,(H,24,25)(H3,21,22,23) |
| InChIKey | SRHACDLIEOLGJW-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 88.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.76 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|