C19H24IN5 — CID 111030155
2-(3-indol-1-ylpropyl)-1-(2-pyridin-2-ylethyl)guanidine;hydroiodide (PubChem CID 111030155) has the molecular formula C19H24IN5 and a molecular weight of 449.34 g/mol. Its IUPAC name is 2-(3-indol-1-ylpropyl)-1-(2-pyridin-2-ylethyl)guanidine;hydroiodide.
| Compound Name | 2-(3-indol-1-ylpropyl)-1-(2-pyridin-2-ylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111030155 |
| Molecular Formula | C19H24IN5 |
| Molecular Weight | 449.34 g/mol |
| Exact Mass | 449.11 |
| IUPAC Name | 2-(3-indol-1-ylpropyl)-1-(2-pyridin-2-ylethyl)guanidine;hydroiodide |
| SMILES | I.N/C(=N\CCCn1ccc2ccccc21)NCCc1ccccn1 |
| InChI | InChI=1S/C19H23N5.HI/c20-19(23-13-9-17-7-3-4-11-21-17)22-12-5-14-24-15-10-16-6-1-2-8-18(16)24;/h1-4,6-8,10-11,15H,5,9,12-14H2,(H3,20,22,23);1H |
| InChIKey | PVCRJWFWWCRBIZ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.34 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|