C14H23N3O3 — CID 111032486
1-propan-2-yl-2-[(2,4,5-trimethoxyphenyl)methyl]guanidine (PubChem CID 111032486) has the molecular formula C14H23N3O3 and a molecular weight of 281.36 g/mol. Its IUPAC name is 1-propan-2-yl-2-[(2,4,5-trimethoxyphenyl)methyl]guanidine.
| Compound Name | 1-propan-2-yl-2-[(2,4,5-trimethoxyphenyl)methyl]guanidine |
|---|---|
| PubChem CID | 111032486 |
| Molecular Formula | C14H23N3O3 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.17 |
| IUPAC Name | 1-propan-2-yl-2-[(2,4,5-trimethoxyphenyl)methyl]guanidine |
| SMILES | COc1cc(OC)c(OC)cc1C/N=C(\N)NC(C)C |
| InChI | InChI=1S/C14H23N3O3/c1-9(2)17-14(15)16-8-10-6-12(19-4)13(20-5)7-11(10)18-3/h6-7,9H,8H2,1-5H3,(H3,15,16,17) |
| InChIKey | BNGCZOJSXNBTFS-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|