C18H21N5O4 — CID 111034329
1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-[2-(2-nitroanilino)ethyl]guanidine (PubChem CID 111034329) has the molecular formula C18H21N5O4 and a molecular weight of 371.40 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-[2-(2-nitroanilino)ethyl]guanidine.
| Compound Name | 1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-[2-(2-nitroanilino)ethyl]guanidine |
|---|---|
| PubChem CID | 111034329 |
| Molecular Formula | C18H21N5O4 |
| Molecular Weight | 371.40 g/mol |
| Exact Mass | 371.16 |
| IUPAC Name | 1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-[2-(2-nitroanilino)ethyl]guanidine |
| SMILES | N/C(=N\CCNc1ccccc1[N+](=O)[O-])Nc1ccc2c(c1)OCCCO2 |
| InChI | InChI=1S/C18H21N5O4/c19-18(21-9-8-20-14-4-1-2-5-15(14)23(24)25)22-13-6-7-16-17(12-13)27-11-3-10-26-16/h1-2,4-7,12,20H,3,8-11H2,(H3,19,21,22) |
| InChIKey | JBERGUWPYNVGMP-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 124.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.40 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|