C25H35BrN2O5S — CID 11103645
tert-butyl (2R)-2-[(2-amino-4-phenylmethoxyphenyl)sulfonyl-(2-bromoethyl)amino]-4-methylpentanoate (PubChem CID 11103645) has the molecular formula C25H35BrN2O5S and a molecular weight of 555.54 g/mol. Its IUPAC name is tert-butyl (2R)-2-[(2-amino-4-phenylmethoxyphenyl)sulfonyl-(2-bromoethyl)amino]-4-methylpentanoate.
| Compound Name | tert-butyl (2R)-2-[(2-amino-4-phenylmethoxyphenyl)sulfonyl-(2-bromoethyl)amino]-4-methylpentanoate |
|---|---|
| PubChem CID | 11103645 |
| Molecular Formula | C25H35BrN2O5S |
| Molecular Weight | 555.54 g/mol |
| Exact Mass | 554.15 |
| IUPAC Name | tert-butyl (2R)-2-[(2-amino-4-phenylmethoxyphenyl)sulfonyl-(2-bromoethyl)amino]-4-methylpentanoate |
| SMILES | CC(C)C[C@H](C(=O)OC(C)(C)C)N(CCBr)S(=O)(=O)c1ccc(OCc2ccccc2)cc1N |
| InChI | InChI=1S/C25H35BrN2O5S/c1-18(2)15-22(24(29)33-25(3,4)5)28(14-13-26)34(30,31)23-12-11-20(16-21(23)27)32-17-19-9-7-6-8-10-19/h6-12,16,18,22H,13-15,17,27H2,1-5H3/t22-/m1/s1 |
| InChIKey | HQJJCPKENGPSLN-JOCHJYFZSA-N |
| XLogP | 4.99 |
| TPSA | 98.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.54 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|