C13H28IN5O2 — CID 111037049
2-[[amino-[(1-ethylpyrrolidin-2-yl)methylamino]methylidene]amino]-N-(2-methoxyethyl)acetamide;hydroiodide (PubChem CID 111037049) has the molecular formula C13H28IN5O2 and a molecular weight of 413.30 g/mol. Its IUPAC name is 2-[[amino-[(1-ethylpyrrolidin-2-yl)methylamino]methylidene]amino]-N-(2-methoxyethyl)acetamide;hydroiodide.
| Compound Name | 2-[[amino-[(1-ethylpyrrolidin-2-yl)methylamino]methylidene]amino]-N-(2-methoxyethyl)acetamide;hydroiodide |
|---|---|
| PubChem CID | 111037049 |
| Molecular Formula | C13H28IN5O2 |
| Molecular Weight | 413.30 g/mol |
| Exact Mass | 413.13 |
| IUPAC Name | 2-[[amino-[(1-ethylpyrrolidin-2-yl)methylamino]methylidene]amino]-N-(2-methoxyethyl)acetamide;hydroiodide |
| SMILES | CCN1CCCC1CN/C(N)=N/CC(=O)NCCOC.I |
| InChI | InChI=1S/C13H27N5O2.HI/c1-3-18-7-4-5-11(18)9-16-13(14)17-10-12(19)15-6-8-20-2;/h11H,3-10H2,1-2H3,(H,15,19)(H3,14,16,17);1H |
| InChIKey | JZRWWEBFVVWUMJ-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 91.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.30 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|