C13H25F3IN5O2 — CID 111914883
N-(2-methoxyethyl)-2-[[N'-methyl-N-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]carbamimidoyl]amino]acetamide;hydroiodide (PubChem CID 111914883) has the molecular formula C13H25F3IN5O2 and a molecular weight of 467.27 g/mol. Its IUPAC name is N-(2-methoxyethyl)-2-[[N'-methyl-N-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]carbamimidoyl]amino]acetamide;hydroiodide.
| Compound Name | N-(2-methoxyethyl)-2-[[N'-methyl-N-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]carbamimidoyl]amino]acetamide;hydroiodide |
|---|---|
| PubChem CID | 111914883 |
| Molecular Formula | C13H25F3IN5O2 |
| Molecular Weight | 467.27 g/mol |
| Exact Mass | 467.10 |
| IUPAC Name | N-(2-methoxyethyl)-2-[[N'-methyl-N-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]carbamimidoyl]amino]acetamide;hydroiodide |
| SMILES | C/N=C(\NCC(=O)NCCOC)NC1CCN(CC(F)(F)F)C1.I |
| InChI | InChI=1S/C13H24F3N5O2.HI/c1-17-12(19-7-11(22)18-4-6-23-2)20-10-3-5-21(8-10)9-13(14,15)16;/h10H,3-9H2,1-2H3,(H,18,22)(H2,17,19,20);1H |
| InChIKey | SNVIQPFILJZGCQ-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 77.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.27 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|