C15H29F3IN5O2 — CID 109377248
2-[[ethylamino-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]methylidene]amino]-N-(2-methoxyethyl)acetamide;hydroiodide (PubChem CID 109377248) has the molecular formula C15H29F3IN5O2 and a molecular weight of 495.33 g/mol. Its IUPAC name is 2-[[ethylamino-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]methylidene]amino]-N-(2-methoxyethyl)acetamide;hydroiodide.
| Compound Name | 2-[[ethylamino-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]methylidene]amino]-N-(2-methoxyethyl)acetamide;hydroiodide |
|---|---|
| PubChem CID | 109377248 |
| Molecular Formula | C15H29F3IN5O2 |
| Molecular Weight | 495.33 g/mol |
| Exact Mass | 495.13 |
| IUPAC Name | 2-[[ethylamino-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]methylidene]amino]-N-(2-methoxyethyl)acetamide;hydroiodide |
| SMILES | CCN/C(=N\CC(=O)NCCOC)N1CCN(C(C)C(F)(F)F)CC1.I |
| InChI | InChI=1S/C15H28F3N5O2.HI/c1-4-19-14(21-11-13(24)20-5-10-25-3)23-8-6-22(7-9-23)12(2)15(16,17)18;/h12H,4-11H2,1-3H3,(H,19,21)(H,20,24);1H |
| InChIKey | FWTGKVCOTPHUIM-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 69.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.33 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|