C10H19F3N4O2 — CID 109472521
N-(2-methoxyethyl)-2-[[N'-methyl-N-(3,3,3-trifluoropropyl)carbamimidoyl]amino]acetamide (PubChem CID 109472521) has the molecular formula C10H19F3N4O2 and a molecular weight of 284.28 g/mol. Its IUPAC name is N-(2-methoxyethyl)-2-[[N'-methyl-N-(3,3,3-trifluoropropyl)carbamimidoyl]amino]acetamide.
| Compound Name | N-(2-methoxyethyl)-2-[[N'-methyl-N-(3,3,3-trifluoropropyl)carbamimidoyl]amino]acetamide |
|---|---|
| PubChem CID | 109472521 |
| Molecular Formula | C10H19F3N4O2 |
| Molecular Weight | 284.28 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | N-(2-methoxyethyl)-2-[[N'-methyl-N-(3,3,3-trifluoropropyl)carbamimidoyl]amino]acetamide |
| SMILES | C/N=C(/NCCC(F)(F)F)NCC(=O)NCCOC |
| InChI | InChI=1S/C10H19F3N4O2/c1-14-9(16-4-3-10(11,12)13)17-7-8(18)15-5-6-19-2/h3-7H2,1-2H3,(H,15,18)(H2,14,16,17) |
| InChIKey | CGCHQZUGILFBSL-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.28 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|