C14H26F3N5O2 — CID 111544729
2-[[(2-methoxyethylamino)-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]amino]methylidene]amino]-N,N-dimethylacetamide (PubChem CID 111544729) has the molecular formula C14H26F3N5O2 and a molecular weight of 353.39 g/mol. Its IUPAC name is 2-[[(2-methoxyethylamino)-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]amino]methylidene]amino]-N,N-dimethylacetamide.
| Compound Name | 2-[[(2-methoxyethylamino)-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]amino]methylidene]amino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 111544729 |
| Molecular Formula | C14H26F3N5O2 |
| Molecular Weight | 353.39 g/mol |
| Exact Mass | 353.20 |
| IUPAC Name | 2-[[(2-methoxyethylamino)-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]amino]methylidene]amino]-N,N-dimethylacetamide |
| SMILES | COCCN/C(=N\CC(=O)N(C)C)NC1CCN(CC(F)(F)F)C1 |
| InChI | InChI=1S/C14H26F3N5O2/c1-21(2)12(23)8-19-13(18-5-7-24-3)20-11-4-6-22(9-11)10-14(15,16)17/h11H,4-10H2,1-3H3,(H2,18,19,20) |
| InChIKey | HQXMASFIDKPGFS-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 69.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.39 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|