C19H38IN5O3 — CID 111038926
ethyl 4-[[N'-[2-(2,6-dimethylmorpholin-4-yl)-2-methylpropyl]carbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide (PubChem CID 111038926) has the molecular formula C19H38IN5O3 and a molecular weight of 511.45 g/mol. Its IUPAC name is ethyl 4-[[N'-[2-(2,6-dimethylmorpholin-4-yl)-2-methylpropyl]carbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide.
| Compound Name | ethyl 4-[[N'-[2-(2,6-dimethylmorpholin-4-yl)-2-methylpropyl]carbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111038926 |
| Molecular Formula | C19H38IN5O3 |
| Molecular Weight | 511.45 g/mol |
| Exact Mass | 511.20 |
| IUPAC Name | ethyl 4-[[N'-[2-(2,6-dimethylmorpholin-4-yl)-2-methylpropyl]carbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide |
| SMILES | CCOC(=O)N1CCC(N/C(N)=N/CC(C)(C)N2CC(C)OC(C)C2)CC1.I |
| InChI | InChI=1S/C19H37N5O3.HI/c1-6-26-18(25)23-9-7-16(8-10-23)22-17(20)21-13-19(4,5)24-11-14(2)27-15(3)12-24;/h14-16H,6-13H2,1-5H3,(H3,20,21,22);1H |
| InChIKey | GKNJXMATDCXZHQ-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.45 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|