C38H40F2N4O8 — CID 11104523
ethyl 1-[(3-benzhydryloxy-3-oxopropanoyl)-methylamino]-6,8-difluoro-7-[4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]-4-oxoquinoline-3-carboxylate (PubChem CID 11104523) has the molecular formula C38H40F2N4O8 and a molecular weight of 718.75 g/mol. Its IUPAC name is ethyl 1-[(3-benzhydryloxy-3-oxopropanoyl)-methylamino]-6,8-difluoro-7-[4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]-4-oxoquinoline-3-carboxylate.
| Compound Name | ethyl 1-[(3-benzhydryloxy-3-oxopropanoyl)-methylamino]-6,8-difluoro-7-[4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]-4-oxoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 11104523 |
| Molecular Formula | C38H40F2N4O8 |
| Molecular Weight | 718.75 g/mol |
| Exact Mass | 718.28 |
| IUPAC Name | ethyl 1-[(3-benzhydryloxy-3-oxopropanoyl)-methylamino]-6,8-difluoro-7-[4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]-4-oxoquinoline-3-carboxylate |
| SMILES | CCOC(=O)c1cn(N(C)C(=O)CC(=O)OC(c2ccccc2)c2ccccc2)c2c(F)c(N3CCN(C(=O)OC(C)(C)C)CC3)c(F)cc2c1=O |
| InChI | InChI=1S/C38H40F2N4O8/c1-6-50-36(48)27-23-44(41(5)29(45)22-30(46)51-35(24-13-9-7-10-14-24)25-15-11-8-12-16-25)32-26(34(27)47)21-28(39)33(31(32)40)42-17-19-43(20-18-42)37(49)52-38(2,3)4/h7-16,21,23,35H,6,17-20,22H2,1-5H3 |
| InChIKey | UOUOBDIAWKAQDV-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 127.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.75 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|