C50H62Br4O2 — CID 11105081
1,4-bis[4,4-dibromo-3-(4-tert-butylphenyl)but-3-en-1-ynyl]-2,5-dioctoxybenzene (PubChem CID 11105081) has the molecular formula C50H62Br4O2 and a molecular weight of 1014.66 g/mol. Its IUPAC name is 1,4-bis[4,4-dibromo-3-(4-tert-butylphenyl)but-3-en-1-ynyl]-2,5-dioctoxybenzene.
| Compound Name | 1,4-bis[4,4-dibromo-3-(4-tert-butylphenyl)but-3-en-1-ynyl]-2,5-dioctoxybenzene |
|---|---|
| PubChem CID | 11105081 |
| Molecular Formula | C50H62Br4O2 |
| Molecular Weight | 1014.66 g/mol |
| Exact Mass | 1010.15 |
| IUPAC Name | 1,4-bis[4,4-dibromo-3-(4-tert-butylphenyl)but-3-en-1-ynyl]-2,5-dioctoxybenzene |
| SMILES | CCCCCCCCOc1cc(C#CC(=C(Br)Br)c2ccc(C(C)(C)C)cc2)c(OCCCCCCCC)cc1C#CC(=C(Br)Br)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C50H62Br4O2/c1-9-11-13-15-17-19-33-55-45-35-40(26-32-44(48(53)54)38-23-29-42(30-24-38)50(6,7)8)46(56-34-20-18-16-14-12-10-2)36-39(45)25-31-43(47(51)52)37-21-27-41(28-22-37)49(3,4)5/h21-24,27-30,35-36H,9-20,33-34H2,1-8H3 |
| InChIKey | GMUGFOMOTGADDL-UHFFFAOYSA-N |
| XLogP | 16.78 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1014.66 |
| LogP ≤ 5 | 16.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|