C14H21F2N3O2 — CID 111051766
2-[[3-(difluoromethoxy)-4-methoxyphenyl]methyl]-1,1,3,3-tetramethylguanidine (PubChem CID 111051766) has the molecular formula C14H21F2N3O2 and a molecular weight of 301.34 g/mol. Its IUPAC name is 2-[[3-(difluoromethoxy)-4-methoxyphenyl]methyl]-1,1,3,3-tetramethylguanidine.
| Compound Name | 2-[[3-(difluoromethoxy)-4-methoxyphenyl]methyl]-1,1,3,3-tetramethylguanidine |
|---|---|
| PubChem CID | 111051766 |
| Molecular Formula | C14H21F2N3O2 |
| Molecular Weight | 301.34 g/mol |
| Exact Mass | 301.16 |
| IUPAC Name | 2-[[3-(difluoromethoxy)-4-methoxyphenyl]methyl]-1,1,3,3-tetramethylguanidine |
| SMILES | COc1ccc(CN=C(N(C)C)N(C)C)cc1OC(F)F |
| InChI | InChI=1S/C14H21F2N3O2/c1-18(2)14(19(3)4)17-9-10-6-7-11(20-5)12(8-10)21-13(15)16/h6-8,13H,9H2,1-5H3 |
| InChIKey | UGVFNNBMTPZZDG-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 37.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.34 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|