C13H19BrF2IN3O — CID 111095427
2-[[5-bromo-2-(difluoromethoxy)phenyl]methyl]-1,1,3,3-tetramethylguanidine;hydroiodide (PubChem CID 111095427) has the molecular formula C13H19BrF2IN3O and a molecular weight of 478.12 g/mol. Its IUPAC name is 2-[[5-bromo-2-(difluoromethoxy)phenyl]methyl]-1,1,3,3-tetramethylguanidine;hydroiodide.
| Compound Name | 2-[[5-bromo-2-(difluoromethoxy)phenyl]methyl]-1,1,3,3-tetramethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111095427 |
| Molecular Formula | C13H19BrF2IN3O |
| Molecular Weight | 478.12 g/mol |
| Exact Mass | 476.97 |
| IUPAC Name | 2-[[5-bromo-2-(difluoromethoxy)phenyl]methyl]-1,1,3,3-tetramethylguanidine;hydroiodide |
| SMILES | CN(C)C(=NCc1cc(Br)ccc1OC(F)F)N(C)C.I |
| InChI | InChI=1S/C13H18BrF2N3O.HI/c1-18(2)13(19(3)4)17-8-9-7-10(14)5-6-11(9)20-12(15)16;/h5-7,12H,8H2,1-4H3;1H |
| InChIKey | HGGTWWZBFDDGAB-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 28.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.12 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|