C11H22F3N3O2 — CID 111057696
1-(3-ethoxypropyl)-2-[3-(2,2,2-trifluoroethoxy)propyl]guanidine (PubChem CID 111057696) has the molecular formula C11H22F3N3O2 and a molecular weight of 285.31 g/mol. Its IUPAC name is 1-(3-ethoxypropyl)-2-[3-(2,2,2-trifluoroethoxy)propyl]guanidine.
| Compound Name | 1-(3-ethoxypropyl)-2-[3-(2,2,2-trifluoroethoxy)propyl]guanidine |
|---|---|
| PubChem CID | 111057696 |
| Molecular Formula | C11H22F3N3O2 |
| Molecular Weight | 285.31 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | 1-(3-ethoxypropyl)-2-[3-(2,2,2-trifluoroethoxy)propyl]guanidine |
| SMILES | CCOCCCN/C(N)=N/CCCOCC(F)(F)F |
| InChI | InChI=1S/C11H22F3N3O2/c1-2-18-7-3-5-16-10(15)17-6-4-8-19-9-11(12,13)14/h2-9H2,1H3,(H3,15,16,17) |
| InChIKey | JRIDCDULALQKQY-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.31 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|