C16H26IN3O2 — CID 111058029
N'-(2-hydroxy-3-phenylmethoxypropyl)piperidine-1-carboximidamide;hydroiodide (PubChem CID 111058029) has the molecular formula C16H26IN3O2 and a molecular weight of 419.31 g/mol. Its IUPAC name is N'-(2-hydroxy-3-phenylmethoxypropyl)piperidine-1-carboximidamide;hydroiodide.
| Compound Name | N'-(2-hydroxy-3-phenylmethoxypropyl)piperidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111058029 |
| Molecular Formula | C16H26IN3O2 |
| Molecular Weight | 419.31 g/mol |
| Exact Mass | 419.11 |
| IUPAC Name | N'-(2-hydroxy-3-phenylmethoxypropyl)piperidine-1-carboximidamide;hydroiodide |
| SMILES | I.N/C(=N\CC(O)COCc1ccccc1)N1CCCCC1 |
| InChI | InChI=1S/C16H25N3O2.HI/c17-16(19-9-5-2-6-10-19)18-11-15(20)13-21-12-14-7-3-1-4-8-14;/h1,3-4,7-8,15,20H,2,5-6,9-13H2,(H2,17,18);1H |
| InChIKey | CVIWWSOZHRYKQD-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 71.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.31 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|