C16H25N3O2 — CID 111058030
N'-(2-hydroxy-3-phenylmethoxypropyl)piperidine-1-carboximidamide (PubChem CID 111058030) has the molecular formula C16H25N3O2 and a molecular weight of 291.39 g/mol. Its IUPAC name is N'-(2-hydroxy-3-phenylmethoxypropyl)piperidine-1-carboximidamide.
| Compound Name | N'-(2-hydroxy-3-phenylmethoxypropyl)piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 111058030 |
| Molecular Formula | C16H25N3O2 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.19 |
| IUPAC Name | N'-(2-hydroxy-3-phenylmethoxypropyl)piperidine-1-carboximidamide |
| SMILES | N/C(=N\CC(O)COCc1ccccc1)N1CCCCC1 |
| InChI | InChI=1S/C16H25N3O2/c17-16(19-9-5-2-6-10-19)18-11-15(20)13-21-12-14-7-3-1-4-8-14/h1,3-4,7-8,15,20H,2,5-6,9-13H2,(H2,17,18) |
| InChIKey | RBJNFWFNTGHGLT-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 71.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|