C10H24N2 — CID 11105831
(3R,4R)-2,2,5,5-tetramethylhexane-3,4-diamine (PubChem CID 11105831) has the molecular formula C10H24N2 and a molecular weight of 172.32 g/mol. Its IUPAC name is (3R,4R)-2,2,5,5-tetramethylhexane-3,4-diamine.
| Compound Name | (3R,4R)-2,2,5,5-tetramethylhexane-3,4-diamine |
|---|---|
| PubChem CID | 11105831 |
| Molecular Formula | C10H24N2 |
| Molecular Weight | 172.32 g/mol |
| Exact Mass | 172.19 |
| IUPAC Name | (3R,4R)-2,2,5,5-tetramethylhexane-3,4-diamine |
| SMILES | CC(C)(C)[C@@H](N)[C@H](N)C(C)(C)C |
| InChI | InChI=1S/C10H24N2/c1-9(2,3)7(11)8(12)10(4,5)6/h7-8H,11-12H2,1-6H3/t7-,8-/m0/s1 |
| InChIKey | WROMFDZPVVQJRK-YUMQZZPRSA-N |
| XLogP | 1.73 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.32 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |