C23H32IN5 — CID 111061776
1-(2,3-dihydro-1H-inden-5-yl)-2-[2-(4-phenylpiperazin-1-yl)propyl]guanidine;hydroiodide (PubChem CID 111061776) has the molecular formula C23H32IN5 and a molecular weight of 505.45 g/mol. Its IUPAC name is 1-(2,3-dihydro-1H-inden-5-yl)-2-[2-(4-phenylpiperazin-1-yl)propyl]guanidine;hydroiodide.
| Compound Name | 1-(2,3-dihydro-1H-inden-5-yl)-2-[2-(4-phenylpiperazin-1-yl)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111061776 |
| Molecular Formula | C23H32IN5 |
| Molecular Weight | 505.45 g/mol |
| Exact Mass | 505.17 |
| IUPAC Name | 1-(2,3-dihydro-1H-inden-5-yl)-2-[2-(4-phenylpiperazin-1-yl)propyl]guanidine;hydroiodide |
| SMILES | CC(C/N=C(\N)Nc1ccc2c(c1)CCC2)N1CCN(c2ccccc2)CC1.I |
| InChI | InChI=1S/C23H31N5.HI/c1-18(27-12-14-28(15-13-27)22-8-3-2-4-9-22)17-25-23(24)26-21-11-10-19-6-5-7-20(19)16-21;/h2-4,8-11,16,18H,5-7,12-15,17H2,1H3,(H3,24,25,26);1H |
| InChIKey | REGYLGKZLYLSIF-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 56.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.45 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|