C12H20O4 — CID 11107105
methyl 2-[(2R,4aS,8aR)-4a-methyl-3,4,6,7,8,8a-hexahydro-2H-pyrano[3,2-b]pyran-2-yl]acetate (PubChem CID 11107105) has the molecular formula C12H20O4 and a molecular weight of 228.29 g/mol. Its IUPAC name is methyl 2-[(2R,4aS,8aR)-4a-methyl-3,4,6,7,8,8a-hexahydro-2H-pyrano[3,2-b]pyran-2-yl]acetate.
| Compound Name | methyl 2-[(2R,4aS,8aR)-4a-methyl-3,4,6,7,8,8a-hexahydro-2H-pyrano[3,2-b]pyran-2-yl]acetate |
|---|---|
| PubChem CID | 11107105 |
| Molecular Formula | C12H20O4 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | methyl 2-[(2R,4aS,8aR)-4a-methyl-3,4,6,7,8,8a-hexahydro-2H-pyrano[3,2-b]pyran-2-yl]acetate |
| SMILES | COC(=O)C[C@H]1CC[C@]2(C)OCCC[C@H]2O1 |
| InChI | InChI=1S/C12H20O4/c1-12-6-5-9(8-11(13)14-2)16-10(12)4-3-7-15-12/h9-10H,3-8H2,1-2H3/t9-,10-,12+/m1/s1 |
| InChIKey | GVEXRSABPCCEGM-FOGDFJRCSA-N |
| XLogP | 1.67 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |