C10H15NO5 — CID 11107133
(1R,2R,6S,7R)-7-hydroxy-4,4-dimethyl-3,5,11-trioxa-9-azatricyclo[7.3.0.02,6]dodecan-10-one (PubChem CID 11107133) has the molecular formula C10H15NO5 and a molecular weight of 229.23 g/mol. Its IUPAC name is (1R,2R,6S,7R)-7-hydroxy-4,4-dimethyl-3,5,11-trioxa-9-azatricyclo[7.3.0.02,6]dodecan-10-one.
| Compound Name | (1R,2R,6S,7R)-7-hydroxy-4,4-dimethyl-3,5,11-trioxa-9-azatricyclo[7.3.0.02,6]dodecan-10-one |
|---|---|
| PubChem CID | 11107133 |
| Molecular Formula | C10H15NO5 |
| Molecular Weight | 229.23 g/mol |
| Exact Mass | 229.10 |
| IUPAC Name | (1R,2R,6S,7R)-7-hydroxy-4,4-dimethyl-3,5,11-trioxa-9-azatricyclo[7.3.0.02,6]dodecan-10-one |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)[C@H]1COC(=O)N1C[C@H]2O |
| InChI | InChI=1S/C10H15NO5/c1-10(2)15-7-5-4-14-9(13)11(5)3-6(12)8(7)16-10/h5-8,12H,3-4H2,1-2H3/t5-,6-,7-,8+/m1/s1 |
| InChIKey | OEXYMGLPNOXORU-XUTVFYLZSA-N |
| XLogP | -0.30 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.23 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |