C18H21IN6 — CID 111071760
1-(2-phenylethyl)-2-[[4-(1,2,4-triazol-1-yl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111071760) has the molecular formula C18H21IN6 and a molecular weight of 448.31 g/mol. Its IUPAC name is 1-(2-phenylethyl)-2-[[4-(1,2,4-triazol-1-yl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-(2-phenylethyl)-2-[[4-(1,2,4-triazol-1-yl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111071760 |
| Molecular Formula | C18H21IN6 |
| Molecular Weight | 448.31 g/mol |
| Exact Mass | 448.09 |
| IUPAC Name | 1-(2-phenylethyl)-2-[[4-(1,2,4-triazol-1-yl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | I.N/C(=N\Cc1ccc(-n2cncn2)cc1)NCCc1ccccc1 |
| InChI | InChI=1S/C18H20N6.HI/c19-18(21-11-10-15-4-2-1-3-5-15)22-12-16-6-8-17(9-7-16)24-14-20-13-23-24;/h1-9,13-14H,10-12H2,(H3,19,21,22);1H |
| InChIKey | NJAZZIQQFUGLSQ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 81.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.31 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|