C16H16OSi — CID 11107841
1,1-diphenyl-2,3-dihydrosilol-3-ol (PubChem CID 11107841) has the molecular formula C16H16OSi and a molecular weight of 252.39 g/mol. Its IUPAC name is 1,1-diphenyl-2,3-dihydrosilol-3-ol.
| Compound Name | 1,1-diphenyl-2,3-dihydrosilol-3-ol |
|---|---|
| PubChem CID | 11107841 |
| Molecular Formula | C16H16OSi |
| Molecular Weight | 252.39 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | 1,1-diphenyl-2,3-dihydrosilol-3-ol |
| SMILES | OC1C=C[Si](c2ccccc2)(c2ccccc2)C1 |
| InChI | InChI=1S/C16H16OSi/c17-14-11-12-18(13-14,15-7-3-1-4-8-15)16-9-5-2-6-10-16/h1-12,14,17H,13H2 |
| InChIKey | VGUSGIBMFXGIPU-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.39 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|