About 1,1-diphenyl-2,3-dihydrosilol-3-ol
1,1-diphenyl-2,3-dihydrosilol-3-ol (PubChem CID 11107841) has the molecular formula C16H16OSi
and a molecular weight of 252.39 g/mol. Its IUPAC name is 1,1-diphenyl-2,3-dihydrosilol-3-ol.
Molecular Properties
| Compound Name | 1,1-diphenyl-2,3-dihydrosilol-3-ol |
| PubChem CID | 11107841 |
| Molecular Formula | C16H16OSi |
| Molecular Weight | 252.39 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | 1,1-diphenyl-2,3-dihydrosilol-3-ol |
| SMILES | OC1C=C[Si](c2ccccc2)(c2ccccc2)C1 |
| InChI | InChI=1S/C16H16OSi/c17-14-11-12-18(13-14,15-7-3-1-4-8-15)16-9-5-2-6-10-16/h1-12,14,17H,13H2 |
| InChIKey | VGUSGIBMFXGIPU-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.39 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1,1-diphenyl-2,3-dihydrosilol-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-diphenyl-2,3-dihydrosilol-3-ol?
The IUPAC name of 1,1-diphenyl-2,3-dihydrosilol-3-ol (CID 11107841) is 1,1-diphenyl-2,3-dihydrosilol-3-ol.
What is the SMILES notation for 1,1-diphenyl-2,3-dihydrosilol-3-ol?
The canonical SMILES for 1,1-diphenyl-2,3-dihydrosilol-3-ol is OC1C=C[Si](c2ccccc2)(c2ccccc2)C1.
What is the InChIKey of 1,1-diphenyl-2,3-dihydrosilol-3-ol?
The InChIKey is VGUSGIBMFXGIPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16OSi/c17-14-11-12-18(13-14,15-7-3-1-4-8-15)16-9-5-2-6-10-16/h1-12,14,17H,13H2.
What are the key properties of 1,1-diphenyl-2,3-dihydrosilol-3-ol?
1,1-diphenyl-2,3-dihydrosilol-3-ol has a molecular weight of 252.39 g/mol, XLogP of 1.72, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-diphenyl-2,3-dihydrosilol-3-ol is sourced from PubChem (CID 11107841), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).