C22H30N4 — CID 1110798
4-[(4-benzylpiperazin-1-yl)iminomethyl]-N,N-diethylaniline (PubChem CID 1110798) has the molecular formula C22H30N4 and a molecular weight of 350.51 g/mol. Its IUPAC name is 4-[(4-benzylpiperazin-1-yl)iminomethyl]-N,N-diethylaniline.
| Compound Name | 4-[(4-benzylpiperazin-1-yl)iminomethyl]-N,N-diethylaniline |
|---|---|
| PubChem CID | 1110798 |
| Molecular Formula | C22H30N4 |
| Molecular Weight | 350.51 g/mol |
| Exact Mass | 350.25 |
| IUPAC Name | 4-[(4-benzylpiperazin-1-yl)iminomethyl]-N,N-diethylaniline |
| SMILES | CCN(CC)c1ccc(C=NN2CCN(Cc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C22H30N4/c1-3-25(4-2)22-12-10-20(11-13-22)18-23-26-16-14-24(15-17-26)19-21-8-6-5-7-9-21/h5-13,18H,3-4,14-17,19H2,1-2H3 |
| InChIKey | IMZIFRKFRVCUCI-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 22.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.51 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_pipzn(79)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|