C18H32N6O3 — CID 111080307
tert-butyl 4-[N'-[3-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)propyl]carbamimidoyl]piperazine-1-carboxylate (PubChem CID 111080307) has the molecular formula C18H32N6O3 and a molecular weight of 380.49 g/mol. Its IUPAC name is tert-butyl 4-[N'-[3-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)propyl]carbamimidoyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[N'-[3-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)propyl]carbamimidoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 111080307 |
| Molecular Formula | C18H32N6O3 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.25 |
| IUPAC Name | tert-butyl 4-[N'-[3-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)propyl]carbamimidoyl]piperazine-1-carboxylate |
| SMILES | CC(C)c1noc(CCC/N=C(\N)N2CCN(C(=O)OC(C)(C)C)CC2)n1 |
| InChI | InChI=1S/C18H32N6O3/c1-13(2)15-21-14(27-22-15)7-6-8-20-16(19)23-9-11-24(12-10-23)17(25)26-18(3,4)5/h13H,6-12H2,1-5H3,(H2,19,20) |
| InChIKey | UUCXUYHNTQXKCZ-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 110.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|