C15H18FIN4OS — CID 111089306
2-[[amino-(2-thiophen-2-ylethylamino)methylidene]amino]-N-(4-fluorophenyl)acetamide;hydroiodide (PubChem CID 111089306) has the molecular formula C15H18FIN4OS and a molecular weight of 448.31 g/mol. Its IUPAC name is 2-[[amino-(2-thiophen-2-ylethylamino)methylidene]amino]-N-(4-fluorophenyl)acetamide;hydroiodide.
| Compound Name | 2-[[amino-(2-thiophen-2-ylethylamino)methylidene]amino]-N-(4-fluorophenyl)acetamide;hydroiodide |
|---|---|
| PubChem CID | 111089306 |
| Molecular Formula | C15H18FIN4OS |
| Molecular Weight | 448.31 g/mol |
| Exact Mass | 448.02 |
| IUPAC Name | 2-[[amino-(2-thiophen-2-ylethylamino)methylidene]amino]-N-(4-fluorophenyl)acetamide;hydroiodide |
| SMILES | I.N/C(=N\CC(=O)Nc1ccc(F)cc1)NCCc1cccs1 |
| InChI | InChI=1S/C15H17FN4OS.HI/c16-11-3-5-12(6-4-11)20-14(21)10-19-15(17)18-8-7-13-2-1-9-22-13;/h1-6,9H,7-8,10H2,(H,20,21)(H3,17,18,19);1H |
| InChIKey | YXJJJHVUDWALJN-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 79.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.31 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|