C15H24ClIN4O — CID 111092417
N-(3-chloro-2-methylphenyl)-3-[[N'-(2-methylpropyl)carbamimidoyl]amino]propanamide;hydroiodide (PubChem CID 111092417) has the molecular formula C15H24ClIN4O and a molecular weight of 438.74 g/mol. Its IUPAC name is N-(3-chloro-2-methylphenyl)-3-[[N'-(2-methylpropyl)carbamimidoyl]amino]propanamide;hydroiodide.
| Compound Name | N-(3-chloro-2-methylphenyl)-3-[[N'-(2-methylpropyl)carbamimidoyl]amino]propanamide;hydroiodide |
|---|---|
| PubChem CID | 111092417 |
| Molecular Formula | C15H24ClIN4O |
| Molecular Weight | 438.74 g/mol |
| Exact Mass | 438.07 |
| IUPAC Name | N-(3-chloro-2-methylphenyl)-3-[[N'-(2-methylpropyl)carbamimidoyl]amino]propanamide;hydroiodide |
| SMILES | Cc1c(Cl)cccc1NC(=O)CCN/C(N)=N/CC(C)C.I |
| InChI | InChI=1S/C15H23ClN4O.HI/c1-10(2)9-19-15(17)18-8-7-14(21)20-13-6-4-5-12(16)11(13)3;/h4-6,10H,7-9H2,1-3H3,(H,20,21)(H3,17,18,19);1H |
| InChIKey | REELABJZTPZAHO-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 79.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.74 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|