C18H22Cl2N4 — CID 111093363
2-[2-(3,4-dichlorophenyl)-2-methylpropyl]-1-(2-pyridin-2-ylethyl)guanidine (PubChem CID 111093363) has the molecular formula C18H22Cl2N4 and a molecular weight of 365.31 g/mol. Its IUPAC name is 2-[2-(3,4-dichlorophenyl)-2-methylpropyl]-1-(2-pyridin-2-ylethyl)guanidine.
| Compound Name | 2-[2-(3,4-dichlorophenyl)-2-methylpropyl]-1-(2-pyridin-2-ylethyl)guanidine |
|---|---|
| PubChem CID | 111093363 |
| Molecular Formula | C18H22Cl2N4 |
| Molecular Weight | 365.31 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | 2-[2-(3,4-dichlorophenyl)-2-methylpropyl]-1-(2-pyridin-2-ylethyl)guanidine |
| SMILES | CC(C)(C/N=C(\N)NCCc1ccccn1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C18H22Cl2N4/c1-18(2,13-6-7-15(19)16(20)11-13)12-24-17(21)23-10-8-14-5-3-4-9-22-14/h3-7,9,11H,8,10,12H2,1-2H3,(H3,21,23,24) |
| InChIKey | LNSSDQAUNLYRAY-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 63.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.31 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|