C20H33IN4O3 — CID 111093598
1-[(3,4-dimethoxy-5-prop-2-enylphenyl)methyl]-2-methyl-3-(2-morpholin-4-ylethyl)guanidine;hydroiodide (PubChem CID 111093598) has the molecular formula C20H33IN4O3 and a molecular weight of 504.41 g/mol. Its IUPAC name is 1-[(3,4-dimethoxy-5-prop-2-enylphenyl)methyl]-2-methyl-3-(2-morpholin-4-ylethyl)guanidine;hydroiodide.
| Compound Name | 1-[(3,4-dimethoxy-5-prop-2-enylphenyl)methyl]-2-methyl-3-(2-morpholin-4-ylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111093598 |
| Molecular Formula | C20H33IN4O3 |
| Molecular Weight | 504.41 g/mol |
| Exact Mass | 504.16 |
| IUPAC Name | 1-[(3,4-dimethoxy-5-prop-2-enylphenyl)methyl]-2-methyl-3-(2-morpholin-4-ylethyl)guanidine;hydroiodide |
| SMILES | C=CCc1cc(CN/C(=N/C)NCCN2CCOCC2)cc(OC)c1OC.I |
| InChI | InChI=1S/C20H32N4O3.HI/c1-5-6-17-13-16(14-18(25-3)19(17)26-4)15-23-20(21-2)22-7-8-24-9-11-27-12-10-24;/h5,13-14H,1,6-12,15H2,2-4H3,(H2,21,22,23);1H |
| InChIKey | RCNRCZTVHGJLBQ-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.41 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|