C20H33N5O4 — CID 111377967
1-[2-(4-acetylpiperazin-1-yl)ethyl]-2-methyl-3-[(3,4,5-trimethoxyphenyl)methyl]guanidine (PubChem CID 111377967) has the molecular formula C20H33N5O4 and a molecular weight of 407.52 g/mol. Its IUPAC name is 1-[2-(4-acetylpiperazin-1-yl)ethyl]-2-methyl-3-[(3,4,5-trimethoxyphenyl)methyl]guanidine.
| Compound Name | 1-[2-(4-acetylpiperazin-1-yl)ethyl]-2-methyl-3-[(3,4,5-trimethoxyphenyl)methyl]guanidine |
|---|---|
| PubChem CID | 111377967 |
| Molecular Formula | C20H33N5O4 |
| Molecular Weight | 407.52 g/mol |
| Exact Mass | 407.25 |
| IUPAC Name | 1-[2-(4-acetylpiperazin-1-yl)ethyl]-2-methyl-3-[(3,4,5-trimethoxyphenyl)methyl]guanidine |
| SMILES | C/N=C(\NCCN1CCN(C(C)=O)CC1)NCc1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C20H33N5O4/c1-15(26)25-10-8-24(9-11-25)7-6-22-20(21-2)23-14-16-12-17(27-3)19(29-5)18(13-16)28-4/h12-13H,6-11,14H2,1-5H3,(H2,21,22,23) |
| InChIKey | VITWEXFFVNIZPZ-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.52 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|