C19H31N5O — CID 111937575
1-[2-(4-acetylpiperazin-1-yl)ethyl]-3-[(2,4-dimethylphenyl)methyl]-2-methylguanidine (PubChem CID 111937575) has the molecular formula C19H31N5O and a molecular weight of 345.49 g/mol. Its IUPAC name is 1-[2-(4-acetylpiperazin-1-yl)ethyl]-3-[(2,4-dimethylphenyl)methyl]-2-methylguanidine.
| Compound Name | 1-[2-(4-acetylpiperazin-1-yl)ethyl]-3-[(2,4-dimethylphenyl)methyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111937575 |
| Molecular Formula | C19H31N5O |
| Molecular Weight | 345.49 g/mol |
| Exact Mass | 345.25 |
| IUPAC Name | 1-[2-(4-acetylpiperazin-1-yl)ethyl]-3-[(2,4-dimethylphenyl)methyl]-2-methylguanidine |
| SMILES | C/N=C(\NCCN1CCN(C(C)=O)CC1)NCc1ccc(C)cc1C |
| InChI | InChI=1S/C19H31N5O/c1-15-5-6-18(16(2)13-15)14-22-19(20-4)21-7-8-23-9-11-24(12-10-23)17(3)25/h5-6,13H,7-12,14H2,1-4H3,(H2,20,21,22) |
| InChIKey | WBVCDTQWKNDUPS-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.49 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|