C20H35IN4O4 — CID 111839390
2-methyl-1-(2-methyl-3-morpholin-4-ylpropyl)-3-[(3,4,5-trimethoxyphenyl)methyl]guanidine;hydroiodide (PubChem CID 111839390) has the molecular formula C20H35IN4O4 and a molecular weight of 522.43 g/mol. Its IUPAC name is 2-methyl-1-(2-methyl-3-morpholin-4-ylpropyl)-3-[(3,4,5-trimethoxyphenyl)methyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-(2-methyl-3-morpholin-4-ylpropyl)-3-[(3,4,5-trimethoxyphenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111839390 |
| Molecular Formula | C20H35IN4O4 |
| Molecular Weight | 522.43 g/mol |
| Exact Mass | 522.17 |
| IUPAC Name | 2-methyl-1-(2-methyl-3-morpholin-4-ylpropyl)-3-[(3,4,5-trimethoxyphenyl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1cc(OC)c(OC)c(OC)c1)NCC(C)CN1CCOCC1.I |
| InChI | InChI=1S/C20H34N4O4.HI/c1-15(14-24-6-8-28-9-7-24)12-22-20(21-2)23-13-16-10-17(25-3)19(27-5)18(11-16)26-4;/h10-11,15H,6-9,12-14H2,1-5H3,(H2,21,22,23);1H |
| InChIKey | PSIKPGHYGNDJQK-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.43 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|