C16H24BrIN4O — CID 111094178
3-bromo-N-[3-[[N'-(cyclobutylmethyl)carbamimidoyl]amino]propyl]benzamide;hydroiodide (PubChem CID 111094178) has the molecular formula C16H24BrIN4O and a molecular weight of 495.20 g/mol. Its IUPAC name is 3-bromo-N-[3-[[N'-(cyclobutylmethyl)carbamimidoyl]amino]propyl]benzamide;hydroiodide.
| Compound Name | 3-bromo-N-[3-[[N'-(cyclobutylmethyl)carbamimidoyl]amino]propyl]benzamide;hydroiodide |
|---|---|
| PubChem CID | 111094178 |
| Molecular Formula | C16H24BrIN4O |
| Molecular Weight | 495.20 g/mol |
| Exact Mass | 494.02 |
| IUPAC Name | 3-bromo-N-[3-[[N'-(cyclobutylmethyl)carbamimidoyl]amino]propyl]benzamide;hydroiodide |
| SMILES | I.N/C(=N\CC1CCC1)NCCCNC(=O)c1cccc(Br)c1 |
| InChI | InChI=1S/C16H23BrN4O.HI/c17-14-7-2-6-13(10-14)15(22)19-8-3-9-20-16(18)21-11-12-4-1-5-12;/h2,6-7,10,12H,1,3-5,8-9,11H2,(H,19,22)(H3,18,20,21);1H |
| InChIKey | AXVHWJCXCCBTDL-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 79.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.20 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|