C19H32N8O — CID 111095916
2-[(1-ethylpyrrolidin-2-yl)methyl]-1-[3-oxo-3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]guanidine (PubChem CID 111095916) has the molecular formula C19H32N8O and a molecular weight of 388.52 g/mol. Its IUPAC name is 2-[(1-ethylpyrrolidin-2-yl)methyl]-1-[3-oxo-3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]guanidine.
| Compound Name | 2-[(1-ethylpyrrolidin-2-yl)methyl]-1-[3-oxo-3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]guanidine |
|---|---|
| PubChem CID | 111095916 |
| Molecular Formula | C19H32N8O |
| Molecular Weight | 388.52 g/mol |
| Exact Mass | 388.27 |
| IUPAC Name | 2-[(1-ethylpyrrolidin-2-yl)methyl]-1-[3-oxo-3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]guanidine |
| SMILES | CCN1CCCC1C/N=C(\N)NCCC(=O)N1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C19H32N8O/c1-2-25-10-3-5-16(25)15-24-18(20)21-9-6-17(28)26-11-13-27(14-12-26)19-22-7-4-8-23-19/h4,7-8,16H,2-3,5-6,9-15H2,1H3,(H3,20,21,24) |
| InChIKey | MDFUBGGIWVDKEU-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 102.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.52 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|