C18H36IN5O3 — CID 111098324
tert-butyl 4-[N'-[[1-(2-methoxyethyl)pyrrolidin-2-yl]methyl]carbamimidoyl]piperazine-1-carboxylate;hydroiodide (PubChem CID 111098324) has the molecular formula C18H36IN5O3 and a molecular weight of 497.42 g/mol. Its IUPAC name is tert-butyl 4-[N'-[[1-(2-methoxyethyl)pyrrolidin-2-yl]methyl]carbamimidoyl]piperazine-1-carboxylate;hydroiodide.
| Compound Name | tert-butyl 4-[N'-[[1-(2-methoxyethyl)pyrrolidin-2-yl]methyl]carbamimidoyl]piperazine-1-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111098324 |
| Molecular Formula | C18H36IN5O3 |
| Molecular Weight | 497.42 g/mol |
| Exact Mass | 497.19 |
| IUPAC Name | tert-butyl 4-[N'-[[1-(2-methoxyethyl)pyrrolidin-2-yl]methyl]carbamimidoyl]piperazine-1-carboxylate;hydroiodide |
| SMILES | COCCN1CCCC1C/N=C(\N)N1CCN(C(=O)OC(C)(C)C)CC1.I |
| InChI | InChI=1S/C18H35N5O3.HI/c1-18(2,3)26-17(24)23-10-8-22(9-11-23)16(19)20-14-15-6-5-7-21(15)12-13-25-4;/h15H,5-14H2,1-4H3,(H2,19,20);1H |
| InChIKey | AHURZQFAGPMQQC-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.42 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|