C20H20O5 — CID 11110578
(1R,5S,6R,7R)-6,7-bis(phenylmethoxy)-2,8-dioxabicyclo[3.2.1]octan-4-one (PubChem CID 11110578) has the molecular formula C20H20O5 and a molecular weight of 340.38 g/mol. Its IUPAC name is (1R,5S,6R,7R)-6,7-bis(phenylmethoxy)-2,8-dioxabicyclo[3.2.1]octan-4-one.
| Compound Name | (1R,5S,6R,7R)-6,7-bis(phenylmethoxy)-2,8-dioxabicyclo[3.2.1]octan-4-one |
|---|---|
| PubChem CID | 11110578 |
| Molecular Formula | C20H20O5 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.13 |
| IUPAC Name | (1R,5S,6R,7R)-6,7-bis(phenylmethoxy)-2,8-dioxabicyclo[3.2.1]octan-4-one |
| SMILES | O=C1CO[C@@H]2O[C@H]1[C@H](OCc1ccccc1)[C@H]2OCc1ccccc1 |
| InChI | InChI=1S/C20H20O5/c21-16-13-24-20-19(23-12-15-9-5-2-6-10-15)18(17(16)25-20)22-11-14-7-3-1-4-8-14/h1-10,17-20H,11-13H2/t17-,18+,19-,20-/m1/s1 |
| InChIKey | LIEZIVXGKAPIPX-IYWMVGAKSA-N |
| XLogP | 2.48 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |