C14H18N2O6S — CID 11110636
ethyl 1,5-dimethyl-2-phenylpyrazol-2-ium-3-carboxylate;hydrogen sulfate (PubChem CID 11110636) has the molecular formula C14H18N2O6S and a molecular weight of 342.37 g/mol. Its IUPAC name is ethyl 1,5-dimethyl-2-phenylpyrazol-2-ium-3-carboxylate;hydrogen sulfate.
| Compound Name | ethyl 1,5-dimethyl-2-phenylpyrazol-2-ium-3-carboxylate;hydrogen sulfate |
|---|---|
| PubChem CID | 11110636 |
| Molecular Formula | C14H18N2O6S |
| Molecular Weight | 342.37 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | ethyl 1,5-dimethyl-2-phenylpyrazol-2-ium-3-carboxylate;hydrogen sulfate |
| SMILES | CCOC(=O)c1cc(C)n(C)[n+]1-c1ccccc1.O=S(=O)([O-])O |
| InChI | InChI=1S/C14H17N2O2.H2O4S/c1-4-18-14(17)13-10-11(2)15(3)16(13)12-8-6-5-7-9-12;1-5(2,3)4/h5-10H,4H2,1-3H3;(H2,1,2,3,4)/q+1;/p-1 |
| InChIKey | XTYCDQTZVMDKNQ-UHFFFAOYSA-M |
| XLogP | 0.79 |
| TPSA | 112.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.37 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|